C16H23N5O2 — CID 130228437
tert-butyl 4-(4-azidophenyl)-1,4-diazepane-1-carboxylate (PubChem CID 130228437) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl 4-(4-azidophenyl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(4-azidophenyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 130228437 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | tert-butyl 4-(4-azidophenyl)-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(c2ccc(N=[N+]=[N-])cc2)CC1 |
| InChI | InChI=1S/C16H23N5O2/c1-16(2,3)23-15(22)21-10-4-9-20(11-12-21)14-7-5-13(6-8-14)18-19-17/h5-8H,4,9-12H2,1-3H3 |
| InChIKey | MYUYTQMUAUEBTH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|