C20H31N3O3 — CID 153455090
tert-butyl 4-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-1,4-diazepane-1-carboxylate (PubChem CID 153455090) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 153455090 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | tert-butyl 4-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-1,4-diazepane-1-carboxylate |
| SMILES | CN(C)C(=O)Cc1ccc(N2CCCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H31N3O3/c1-20(2,3)26-19(25)23-12-6-11-22(13-14-23)17-9-7-16(8-10-17)15-18(24)21(4)5/h7-10H,6,11-15H2,1-5H3 |
| InChIKey | WQSHEOPQEADMCL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|