C23H29N3O3 — CID 69365153
benzyl 4-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-1,4-diazepane-1-carboxylate (PubChem CID 69365153) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is benzyl 4-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-1,4-diazepane-1-carboxylate.
| Compound Name | benzyl 4-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 69365153 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | benzyl 4-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-1,4-diazepane-1-carboxylate |
| SMILES | CN(C)C(=O)Cc1ccc(N2CCCN(C(=O)OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-24(2)22(27)17-19-9-11-21(12-10-19)25-13-6-14-26(16-15-25)23(28)29-18-20-7-4-3-5-8-20/h3-5,7-12H,6,13-18H2,1-2H3 |
| InChIKey | PDZWDDRCJUSKSE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|