C22H28N2O6 — CID 176656702
benzyl 4-[3,4-bis(methoxymethoxy)phenyl]piperazine-1-carboxylate (PubChem CID 176656702) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is benzyl 4-[3,4-bis(methoxymethoxy)phenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[3,4-bis(methoxymethoxy)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176656702 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | benzyl 4-[3,4-bis(methoxymethoxy)phenyl]piperazine-1-carboxylate |
| SMILES | COCOc1ccc(N2CCN(C(=O)OCc3ccccc3)CC2)cc1OCOC |
| InChI | InChI=1S/C22H28N2O6/c1-26-16-29-20-9-8-19(14-21(20)30-17-27-2)23-10-12-24(13-11-23)22(25)28-15-18-6-4-3-5-7-18/h3-9,14H,10-13,15-17H2,1-2H3 |
| InChIKey | JATUKSWYHKONFH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|