C20H23N3O2 — CID 133060815
benzyl 4-(2,3-dihydro-1H-indol-6-yl)piperazine-1-carboxylate (PubChem CID 133060815) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is benzyl 4-(2,3-dihydro-1H-indol-6-yl)piperazine-1-carboxylate.
| Compound Name | benzyl 4-(2,3-dihydro-1H-indol-6-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 133060815 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | benzyl 4-(2,3-dihydro-1H-indol-6-yl)piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2ccc3c(c2)NCC3)CC1 |
| InChI | InChI=1S/C20H23N3O2/c24-20(25-15-16-4-2-1-3-5-16)23-12-10-22(11-13-23)18-7-6-17-8-9-21-19(17)14-18/h1-7,14,21H,8-13,15H2 |
| InChIKey | LEYPPQRKBWRELC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |