C26H28N4O2 — CID 66863213
benzyl 4-[4-(3,4-dihydro-2H-quinoxalin-1-yl)phenyl]piperazine-1-carboxylate (PubChem CID 66863213) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is benzyl 4-[4-(3,4-dihydro-2H-quinoxalin-1-yl)phenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[4-(3,4-dihydro-2H-quinoxalin-1-yl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 66863213 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | benzyl 4-[4-(3,4-dihydro-2H-quinoxalin-1-yl)phenyl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2ccc(N3CCNc4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C26H28N4O2/c31-26(32-20-21-6-2-1-3-7-21)29-18-16-28(17-19-29)22-10-12-23(13-11-22)30-15-14-27-24-8-4-5-9-25(24)30/h1-13,27H,14-20H2 |
| InChIKey | MQZGCADRRCVUPB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|