C20H22FNO5 — CID 155273044
benzyl 3-[4-fluoro-2-(methoxymethoxy)phenyl]-3-hydroxypyrrolidine-1-carboxylate (PubChem CID 155273044) has the molecular formula C20H22FNO5 and a molecular weight of 375.40 g/mol. Its IUPAC name is benzyl 3-[4-fluoro-2-(methoxymethoxy)phenyl]-3-hydroxypyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-[4-fluoro-2-(methoxymethoxy)phenyl]-3-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155273044 |
| Molecular Formula | C20H22FNO5 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | benzyl 3-[4-fluoro-2-(methoxymethoxy)phenyl]-3-hydroxypyrrolidine-1-carboxylate |
| SMILES | COCOc1cc(F)ccc1C1(O)CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C20H22FNO5/c1-25-14-27-18-11-16(21)7-8-17(18)20(24)9-10-22(13-20)19(23)26-12-15-5-3-2-4-6-15/h2-8,11,24H,9-10,12-14H2,1H3 |
| InChIKey | YGSFLHRVUWNYOW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|