benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate

C13H16FNO3 — CID 121242240

IUPACbenzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate
SMILESO=C(OCc1ccccc1)N1CC[C@](F)(CO)C1
InChIInChI=1S/C13H16FNO3/c14-13(10-16)6-7-15(9-13)12(17)18-8-11-4-2-1-3-5-11/h1-5,16H,6-10H2/t13-/m1/s1
InChIKeyMDSGTKLDIYJRNX-CYBMUJFWSA-N
MW253.27 g/mol
LogP1.73
Rot. Bonds3

About benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate

benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate (PubChem CID 121242240) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate.

Molecular Properties

Compound Namebenzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate
PubChem CID121242240
Molecular FormulaC13H16FNO3
Molecular Weight253.27 g/mol
Exact Mass253.11
IUPAC Namebenzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate
SMILESO=C(OCc1ccccc1)N1CC[C@](F)(CO)C1
InChIInChI=1S/C13H16FNO3/c14-13(10-16)6-7-15(9-13)12(17)18-8-11-4-2-1-3-5-11/h1-5,16H,6-10H2/t13-/m1/s1
InChIKeyMDSGTKLDIYJRNX-CYBMUJFWSA-N
XLogP1.73
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.27
LogP ≤ 51.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate?
The IUPAC name of benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CID 121242240) is benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate is O=C(OCc1ccccc1)N1CC[C@](F)(CO)C1.
What is the InChIKey of benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate?
The InChIKey is MDSGTKLDIYJRNX-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H16FNO3/c14-13(10-16)6-7-15(9-13)12(17)18-8-11-4-2-1-3-5-11/h1-5,16H,6-10H2/t13-/m1/s1.
What are the key properties of benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate?
benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate has a molecular weight of 253.27 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 121242240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).