About benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate
benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate (PubChem CID 167708022) has the molecular formula C28H35FN2O6
and a molecular weight of 514.59 g/mol. Its IUPAC name is benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate |
| PubChem CID | 167708022 |
| Molecular Formula | C28H35FN2O6 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(F)(CO)CC1.O=C(OCc1ccccc1)N1CCC2(CC1)CO2 |
| InChI | InChI=1S/C14H18FNO3.C14H17NO3/c15-14(11-17)6-8-16(9-7-14)13(18)19-10-12-4-2-1-3-5-12;16-13(17-10-12-4-2-1-3-5-12)15-8-6-14(7-9-15)11-18-14/h1-5,17H,6-11H2;1-5H,6-11H2 |
| InChIKey | ZJZXWXWFGZKNHG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate?
The IUPAC name of benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate (CID 167708022) is benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate.
What is the SMILES notation for benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate?
The canonical SMILES for benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate is O=C(OCc1ccccc1)N1CCC(F)(CO)CC1.O=C(OCc1ccccc1)N1CCC2(CC1)CO2.
What is the InChIKey of benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate?
The InChIKey is ZJZXWXWFGZKNHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO3.C14H17NO3/c15-14(11-17)6-8-16(9-7-14)13(18)19-10-12-4-2-1-3-5-12;16-13(17-10-12-4-2-1-3-5-12)15-8-6-14(7-9-15)11-18-14/h1-5,17H,6-11H2;1-5H,6-11H2.
What are the key properties of benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate?
benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate has a molecular weight of 514.59 g/mol, XLogP of 4.31, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate;benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate is sourced from PubChem (CID 167708022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).