benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate

C17H21NO4 — CID 165343304

IUPACbenzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate
SMILESO=C1CCC2(CCCN(C(=O)OCc3ccccc3)CC2)O1
InChIInChI=1S/C17H21NO4/c19-15-7-9-17(22-15)8-4-11-18(12-10-17)16(20)21-13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2
InChIKeyBHLVMDMFIIXCPK-UHFFFAOYSA-N
MW303.36 g/mol
LogP2.88
Rot. Bonds2

About benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate

benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate (PubChem CID 165343304) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate.

Molecular Properties

Compound Namebenzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate
PubChem CID165343304
Molecular FormulaC17H21NO4
Molecular Weight303.36 g/mol
Exact Mass303.15
IUPAC Namebenzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate
SMILESO=C1CCC2(CCCN(C(=O)OCc3ccccc3)CC2)O1
InChIInChI=1S/C17H21NO4/c19-15-7-9-17(22-15)8-4-11-18(12-10-17)16(20)21-13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2
InChIKeyBHLVMDMFIIXCPK-UHFFFAOYSA-N
XLogP2.88
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.36
LogP ≤ 52.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate?
The IUPAC name of benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate (CID 165343304) is benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate.
What is the SMILES notation for benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate?
The canonical SMILES for benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate is O=C1CCC2(CCCN(C(=O)OCc3ccccc3)CC2)O1.
What is the InChIKey of benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate?
The InChIKey is BHLVMDMFIIXCPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO4/c19-15-7-9-17(22-15)8-4-11-18(12-10-17)16(20)21-13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2.
What are the key properties of benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate?
benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate has a molecular weight of 303.36 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-oxo-1-oxa-9-azaspiro[4.6]undecane-9-carboxylate is sourced from PubChem (CID 165343304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).