C27H29N3O4 — CID 59419487
benzyl 4-[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 59419487) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is benzyl 4-[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59419487 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | benzyl 4-[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(CC(=O)Nc2ccc(N3CCN(C(=O)OCc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H29N3O4/c1-33-25-13-7-21(8-14-25)19-26(31)28-23-9-11-24(12-10-23)29-15-17-30(18-16-29)27(32)34-20-22-5-3-2-4-6-22/h2-14H,15-20H2,1H3,(H,28,31) |
| InChIKey | HGSTXWJAFSWSHW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|