C30H30N4O4 — CID 42768607
2-(4-methoxyphenyl)-N-[4-[4-(4-methoxyquinoline-2-carbonyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 42768607) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[4-[4-(4-methoxyquinoline-2-carbonyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[4-[4-(4-methoxyquinoline-2-carbonyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 42768607 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[4-[4-(4-methoxyquinoline-2-carbonyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(N3CCN(C(=O)c4cc(OC)c5ccccc5n4)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H30N4O4/c1-37-24-13-7-21(8-14-24)19-29(35)31-22-9-11-23(12-10-22)33-15-17-34(18-16-33)30(36)27-20-28(38-2)25-5-3-4-6-26(25)32-27/h3-14,20H,15-19H2,1-2H3,(H,31,35) |
| InChIKey | BONOZLUNGRGHTJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|