C28H24ClN5O5 — CID 1057778
2-chloro-N-[4-[4-(4-methoxyquinoline-2-carbonyl)piperazin-1-yl]phenyl]-4-nitrobenzamide (PubChem CID 1057778) has the molecular formula C28H24ClN5O5 and a molecular weight of 545.98 g/mol. Its IUPAC name is 2-chloro-N-[4-[4-(4-methoxyquinoline-2-carbonyl)piperazin-1-yl]phenyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-[4-(4-methoxyquinoline-2-carbonyl)piperazin-1-yl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 1057778 |
| Molecular Formula | C28H24ClN5O5 |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 2-chloro-N-[4-[4-(4-methoxyquinoline-2-carbonyl)piperazin-1-yl]phenyl]-4-nitrobenzamide |
| SMILES | COc1cc(C(=O)N2CCN(c3ccc(NC(=O)c4ccc([N+](=O)[O-])cc4Cl)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C28H24ClN5O5/c1-39-26-17-25(31-24-5-3-2-4-22(24)26)28(36)33-14-12-32(13-15-33)19-8-6-18(7-9-19)30-27(35)21-11-10-20(34(37)38)16-23(21)29/h2-11,16-17H,12-15H2,1H3,(H,30,35) |
| InChIKey | ANWCEBVBRRMZER-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|