C29H32ClN5O6 — CID 5109465
5-[(2-chloro-4-nitrobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide (PubChem CID 5109465) has the molecular formula C29H32ClN5O6 and a molecular weight of 582.06 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 5-[(2-chloro-4-nitrobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 5109465 |
| Molecular Formula | C29H32ClN5O6 |
| Molecular Weight | 582.06 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 5-[(2-chloro-4-nitrobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C29H32ClN5O6/c1-40-17-5-12-31-28(36)23-18-20(32-29(37)22-10-9-21(35(38)39)19-24(22)30)8-11-25(23)33-13-15-34(16-14-33)26-6-3-4-7-27(26)41-2/h3-4,6-11,18-19H,5,12-17H2,1-2H3,(H,31,36)(H,32,37) |
| InChIKey | BDFJTSMJSAVEOJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.06 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|