C29H33Cl2N5O4 — CID 42660064
5-[(2,4-dichlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide (PubChem CID 42660064) has the molecular formula C29H33Cl2N5O4 and a molecular weight of 586.52 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 5-[(2,4-dichlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 42660064 |
| Molecular Formula | C29H33Cl2N5O4 |
| Molecular Weight | 586.52 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)Nc2ccc(Cl)cc2Cl)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C29H33Cl2N5O4/c1-39-17-5-12-32-28(37)22-19-21(33-29(38)34-24-10-8-20(30)18-23(24)31)9-11-25(22)35-13-15-36(16-14-35)26-6-3-4-7-27(26)40-2/h3-4,6-11,18-19H,5,12-17H2,1-2H3,(H,32,37)(H2,33,34,38) |
| InChIKey | MJVASYWRGNSWGH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|