C32H41N5O4 — CID 42662088
N-(3-ethoxypropyl)-5-[(2-ethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42662088) has the molecular formula C32H41N5O4 and a molecular weight of 559.71 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5-[(2-ethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-(3-ethoxypropyl)-5-[(2-ethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42662088 |
| Molecular Formula | C32H41N5O4 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.32 |
| IUPAC Name | N-(3-ethoxypropyl)-5-[(2-ethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)Nc2ccccc2CC)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C32H41N5O4/c1-4-24-11-6-7-12-27(24)35-32(39)34-25-15-16-28(26(23-25)31(38)33-17-10-22-41-5-2)36-18-20-37(21-19-36)29-13-8-9-14-30(29)40-3/h6-9,11-16,23H,4-5,10,17-22H2,1-3H3,(H,33,38)(H2,34,35,39) |
| InChIKey | PZOUHEVXDACUAU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|