C31H44N4O4 — CID 3494735
5-(3-cyclopentylpropanoylamino)-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 3494735) has the molecular formula C31H44N4O4 and a molecular weight of 536.72 g/mol. Its IUPAC name is 5-(3-cyclopentylpropanoylamino)-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-(3-cyclopentylpropanoylamino)-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 3494735 |
| Molecular Formula | C31H44N4O4 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | 5-(3-cyclopentylpropanoylamino)-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)CCC2CCCC2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C31H44N4O4/c1-3-39-22-8-17-32-31(37)26-23-25(33-30(36)16-13-24-9-4-5-10-24)14-15-27(26)34-18-20-35(21-19-34)28-11-6-7-12-29(28)38-2/h6-7,11-12,14-15,23-24H,3-5,8-10,13,16-22H2,1-2H3,(H,32,37)(H,33,36) |
| InChIKey | DKSGNCJNZFNNLY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|