C33H50N4O4 — CID 4603623
5-(decanoylamino)-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 4603623) has the molecular formula C33H50N4O4 and a molecular weight of 566.79 g/mol. Its IUPAC name is 5-(decanoylamino)-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-(decanoylamino)-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 4603623 |
| Molecular Formula | C33H50N4O4 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | 5-(decanoylamino)-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(N2CCN(c3ccccc3OC)CC2)c(C(=O)NCCCOCC)c1 |
| InChI | InChI=1S/C33H50N4O4/c1-4-6-7-8-9-10-11-17-32(38)35-27-18-19-29(28(26-27)33(39)34-20-14-25-41-5-2)36-21-23-37(24-22-36)30-15-12-13-16-31(30)40-3/h12-13,15-16,18-19,26H,4-11,14,17,20-25H2,1-3H3,(H,34,39)(H,35,38) |
| InChIKey | KLAQNYJYKPODOE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|