C31H38N4O4 — CID 3504402
N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-methylbenzoyl)amino]benzamide (PubChem CID 3504402) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-methylbenzoyl)amino]benzamide.
| Compound Name | N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-methylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 3504402 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-methylbenzoyl)amino]benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)c2ccccc2C)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C31H38N4O4/c1-4-39-21-9-16-32-30(36)26-22-24(33-31(37)25-11-6-5-10-23(25)2)14-15-27(26)34-17-19-35(20-18-34)28-12-7-8-13-29(28)38-3/h5-8,10-15,22H,4,9,16-21H2,1-3H3,(H,32,36)(H,33,37) |
| InChIKey | WKILDNLSHLYKCC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|