C31H39N5O4 — CID 3953573
5-[(3,4-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide (PubChem CID 3953573) has the molecular formula C31H39N5O4 and a molecular weight of 545.68 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 5-[(3,4-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 3953573 |
| Molecular Formula | C31H39N5O4 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | 5-[(3,4-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)Nc2ccc(C)c(C)c2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C31H39N5O4/c1-22-10-11-24(20-23(22)2)33-31(38)34-25-12-13-27(26(21-25)30(37)32-14-7-19-39-3)35-15-17-36(18-16-35)28-8-5-6-9-29(28)40-4/h5-6,8-13,20-21H,7,14-19H2,1-4H3,(H,32,37)(H2,33,34,38) |
| InChIKey | GBLPMNSAZFZFIF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|