C35H39N5O3 — CID 3250365
5-[(2,6-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide (PubChem CID 3250365) has the molecular formula C35H39N5O3 and a molecular weight of 577.73 g/mol. Its IUPAC name is 5-[(2,6-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide.
| Compound Name | 5-[(2,6-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 3250365 |
| Molecular Formula | C35H39N5O3 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | 5-[(2,6-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3c(C)cccc3C)cc2C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C35H39N5O3/c1-25-10-9-11-26(2)33(25)38-35(42)37-28-16-17-30(29(24-28)34(41)36-19-18-27-12-5-4-6-13-27)39-20-22-40(23-21-39)31-14-7-8-15-32(31)43-3/h4-17,24H,18-23H2,1-3H3,(H,36,41)(H2,37,38,42) |
| InChIKey | OCVLUSYWWLDXPM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|