C37H37N5O3 — CID 42660840
2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)-N-(2-phenylethyl)benzamide (PubChem CID 42660840) has the molecular formula C37H37N5O3 and a molecular weight of 599.74 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42660840 |
| Molecular Formula | C37H37N5O3 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(naphthalen-1-ylcarbamoylamino)-N-(2-phenylethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3cccc4ccccc34)cc2C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C37H37N5O3/c1-45-35-17-8-7-16-34(35)42-24-22-41(23-25-42)33-19-18-29(26-31(33)36(43)38-21-20-27-10-3-2-4-11-27)39-37(44)40-32-15-9-13-28-12-5-6-14-30(28)32/h2-19,26H,20-25H2,1H3,(H,38,43)(H2,39,40,44) |
| InChIKey | CMTSHVIPLHLPOD-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|