C34H36N4O3 — CID 1064740
N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-phenylpropanoylamino)benzamide (PubChem CID 1064740) has the molecular formula C34H36N4O3 and a molecular weight of 548.69 g/mol. Its IUPAC name is N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-phenylpropanoylamino)benzamide.
| Compound Name | N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-phenylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 1064740 |
| Molecular Formula | C34H36N4O3 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-phenylpropanoylamino)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)CCc3ccccc3)cc2C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C34H36N4O3/c1-41-32-15-9-8-14-31(32)38-22-20-37(21-23-38)30-18-17-28(36-33(39)19-16-26-10-4-2-5-11-26)24-29(30)34(40)35-25-27-12-6-3-7-13-27/h2-15,17-18,24H,16,19-23,25H2,1H3,(H,35,40)(H,36,39) |
| InChIKey | DEMBRSDGWHHKNP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|