C34H30F6N4O3 — CID 4008168
N-benzyl-5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 4008168) has the molecular formula C34H30F6N4O3 and a molecular weight of 656.63 g/mol. Its IUPAC name is N-benzyl-5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-benzyl-5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 4008168 |
| Molecular Formula | C34H30F6N4O3 |
| Molecular Weight | 656.63 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | N-benzyl-5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C34H30F6N4O3/c1-47-30-10-6-5-9-29(30)44-15-13-43(14-16-44)28-12-11-26(20-27(28)32(46)41-21-22-7-3-2-4-8-22)42-31(45)23-17-24(33(35,36)37)19-25(18-23)34(38,39)40/h2-12,17-20H,13-16,21H2,1H3,(H,41,46)(H,42,45) |
| InChIKey | UONMDCYCQAADFB-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.63 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|