C30H36N4O3 — CID 3294250
N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(pentanoylamino)benzamide (PubChem CID 3294250) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(pentanoylamino)benzamide.
| Compound Name | N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(pentanoylamino)benzamide |
|---|---|
| PubChem CID | 3294250 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(pentanoylamino)benzamide |
| SMILES | CCCCC(=O)Nc1ccc(N2CCN(c3ccccc3OC)CC2)c(C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C30H36N4O3/c1-3-4-14-29(35)32-24-15-16-26(25(21-24)30(36)31-22-23-10-6-5-7-11-23)33-17-19-34(20-18-33)27-12-8-9-13-28(27)37-2/h5-13,15-16,21H,3-4,14,17-20,22H2,1-2H3,(H,31,36)(H,32,35) |
| InChIKey | PLWQIVRZJCAZDT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|