C32H31BrN4O3 — CID 3941984
N-benzyl-5-[(2-bromobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 3941984) has the molecular formula C32H31BrN4O3 and a molecular weight of 599.53 g/mol. Its IUPAC name is N-benzyl-5-[(2-bromobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-benzyl-5-[(2-bromobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 3941984 |
| Molecular Formula | C32H31BrN4O3 |
| Molecular Weight | 599.53 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | N-benzyl-5-[(2-bromobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccccc3Br)cc2C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H31BrN4O3/c1-40-30-14-8-7-13-29(30)37-19-17-36(18-20-37)28-16-15-24(35-32(39)25-11-5-6-12-27(25)33)21-26(28)31(38)34-22-23-9-3-2-4-10-23/h2-16,21H,17-20,22H2,1H3,(H,34,38)(H,35,39) |
| InChIKey | KTBIOXSCMBYAJS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|