C28H29BrN4O3 — CID 1066531
5-[(2-bromobenzoyl)amino]-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 1066531) has the molecular formula C28H29BrN4O3 and a molecular weight of 549.47 g/mol. Its IUPAC name is 5-[(2-bromobenzoyl)amino]-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[(2-bromobenzoyl)amino]-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 1066531 |
| Molecular Formula | C28H29BrN4O3 |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 5-[(2-bromobenzoyl)amino]-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccccc3Br)cc2C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C28H29BrN4O3/c1-36-26-9-5-4-8-25(26)33-16-14-32(15-17-33)24-13-12-20(18-22(24)28(35)30-19-10-11-19)31-27(34)21-6-2-3-7-23(21)29/h2-9,12-13,18-19H,10-11,14-17H2,1H3,(H,30,35)(H,31,34) |
| InChIKey | FLHRKBRUQDVATF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|