C30H28F6N4O3 — CID 5206586
5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 5206586) has the molecular formula C30H28F6N4O3 and a molecular weight of 606.57 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 5206586 |
| Molecular Formula | C30H28F6N4O3 |
| Molecular Weight | 606.57 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C30H28F6N4O3/c1-43-26-5-3-2-4-25(26)40-12-10-39(11-13-40)24-9-8-22(17-23(24)28(42)37-21-6-7-21)38-27(41)18-14-19(29(31,32)33)16-20(15-18)30(34,35)36/h2-5,8-9,14-17,21H,6-7,10-13H2,1H3,(H,37,42)(H,38,41) |
| InChIKey | BTKKFHBQSLDYNA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|