C26H35N5O3 — CID 42757363
5-(butylcarbamoylamino)-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42757363) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 5-(butylcarbamoylamino)-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-(butylcarbamoylamino)-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42757363 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 5-(butylcarbamoylamino)-N-cyclopropyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCCCNC(=O)Nc1ccc(N2CCN(c3ccccc3OC)CC2)c(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C26H35N5O3/c1-3-4-13-27-26(33)29-20-11-12-22(21(18-20)25(32)28-19-9-10-19)30-14-16-31(17-15-30)23-7-5-6-8-24(23)34-2/h5-8,11-12,18-19H,3-4,9-10,13-17H2,1-2H3,(H,28,32)(H2,27,29,33) |
| InChIKey | SJANISCKBNLLEL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|