C33H41N5O3 — CID 42659981
N-cyclohexyl-5-[(3,4-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42659981) has the molecular formula C33H41N5O3 and a molecular weight of 555.72 g/mol. Its IUPAC name is N-cyclohexyl-5-[(3,4-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-cyclohexyl-5-[(3,4-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42659981 |
| Molecular Formula | C33H41N5O3 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | N-cyclohexyl-5-[(3,4-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3ccc(C)c(C)c3)cc2C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C33H41N5O3/c1-23-13-14-26(21-24(23)2)35-33(40)36-27-15-16-29(28(22-27)32(39)34-25-9-5-4-6-10-25)37-17-19-38(20-18-37)30-11-7-8-12-31(30)41-3/h7-8,11-16,21-22,25H,4-6,9-10,17-20H2,1-3H3,(H,34,39)(H2,35,36,40) |
| InChIKey | WCCSDPZXEMYCHV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|