C32H36N6O3 — CID 42659985
5-[(4-cyanophenyl)carbamoylamino]-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42659985) has the molecular formula C32H36N6O3 and a molecular weight of 552.68 g/mol. Its IUPAC name is 5-[(4-cyanophenyl)carbamoylamino]-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[(4-cyanophenyl)carbamoylamino]-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42659985 |
| Molecular Formula | C32H36N6O3 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 5-[(4-cyanophenyl)carbamoylamino]-N-cyclohexyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3ccc(C#N)cc3)cc2C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C32H36N6O3/c1-41-30-10-6-5-9-29(30)38-19-17-37(18-20-38)28-16-15-26(21-27(28)31(39)34-24-7-3-2-4-8-24)36-32(40)35-25-13-11-23(22-33)12-14-25/h5-6,9-16,21,24H,2-4,7-8,17-20H2,1H3,(H,34,39)(H2,35,36,40) |
| InChIKey | OBFJBUPVBHNVLO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|