C33H32N6O3 — CID 42660178
N-benzyl-5-[(4-cyanophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42660178) has the molecular formula C33H32N6O3 and a molecular weight of 560.66 g/mol. Its IUPAC name is N-benzyl-5-[(4-cyanophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-benzyl-5-[(4-cyanophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42660178 |
| Molecular Formula | C33H32N6O3 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | N-benzyl-5-[(4-cyanophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3ccc(C#N)cc3)cc2C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C33H32N6O3/c1-42-31-10-6-5-9-30(31)39-19-17-38(18-20-39)29-16-15-27(37-33(41)36-26-13-11-24(22-34)12-14-26)21-28(29)32(40)35-23-25-7-3-2-4-8-25/h2-16,21H,17-20,23H2,1H3,(H,35,40)(H2,36,37,41) |
| InChIKey | QFWREJMNTNWXPU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|