C32H30Cl2N4O3 — CID 42660137
N-benzyl-5-[(2,4-dichlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42660137) has the molecular formula C32H30Cl2N4O3 and a molecular weight of 589.52 g/mol. Its IUPAC name is N-benzyl-5-[(2,4-dichlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-benzyl-5-[(2,4-dichlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42660137 |
| Molecular Formula | C32H30Cl2N4O3 |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | N-benzyl-5-[(2,4-dichlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccc(Cl)cc3Cl)cc2C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H30Cl2N4O3/c1-41-30-10-6-5-9-29(30)38-17-15-37(16-18-38)28-14-12-24(36-32(40)25-13-11-23(33)19-27(25)34)20-26(28)31(39)35-21-22-7-3-2-4-8-22/h2-14,19-20H,15-18,21H2,1H3,(H,35,39)(H,36,40) |
| InChIKey | FBCLQQIATCZDNP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|