C33H33ClN4O3 — CID 42755758
5-[(2-chlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide (PubChem CID 42755758) has the molecular formula C33H33ClN4O3 and a molecular weight of 569.11 g/mol. Its IUPAC name is 5-[(2-chlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide.
| Compound Name | 5-[(2-chlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42755758 |
| Molecular Formula | C33H33ClN4O3 |
| Molecular Weight | 569.11 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | 5-[(2-chlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccccc3Cl)cc2C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C33H33ClN4O3/c1-41-31-14-8-7-13-30(31)38-21-19-37(20-22-38)29-16-15-25(36-33(40)26-11-5-6-12-28(26)34)23-27(29)32(39)35-18-17-24-9-3-2-4-10-24/h2-16,23H,17-22H2,1H3,(H,35,39)(H,36,40) |
| InChIKey | JXMUEUOVDIIERC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.11 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|