C34H34F3N5O3 — CID 42756318
2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 42756318) has the molecular formula C34H34F3N5O3 and a molecular weight of 617.67 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 42756318 |
| Molecular Formula | C34H34F3N5O3 |
| Molecular Weight | 617.67 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3ccccc3C(F)(F)F)cc2C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C34H34F3N5O3/c1-45-31-14-8-7-13-30(31)42-21-19-41(20-22-42)29-16-15-25(23-26(29)32(43)38-18-17-24-9-3-2-4-10-24)39-33(44)40-28-12-6-5-11-27(28)34(35,36)37/h2-16,23H,17-22H2,1H3,(H,38,43)(H2,39,40,44) |
| InChIKey | RXJZBNRJPVAIMB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.67 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|