C32H40N4O3 — CID 42755771
5-(3,3-dimethylbutanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide (PubChem CID 42755771) has the molecular formula C32H40N4O3 and a molecular weight of 528.70 g/mol. Its IUPAC name is 5-(3,3-dimethylbutanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide.
| Compound Name | 5-(3,3-dimethylbutanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42755771 |
| Molecular Formula | C32H40N4O3 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 5-(3,3-dimethylbutanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)CC(C)(C)C)cc2C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H40N4O3/c1-32(2,3)23-30(37)34-25-14-15-27(26(22-25)31(38)33-17-16-24-10-6-5-7-11-24)35-18-20-36(21-19-35)28-12-8-9-13-29(28)39-4/h5-15,22H,16-21,23H2,1-4H3,(H,33,38)(H,34,37) |
| InChIKey | YJJIAGKYVVGHSQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|