C30H43N5O4 — CID 1064588
5-(3,3-dimethylbutanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 1064588) has the molecular formula C30H43N5O4 and a molecular weight of 537.71 g/mol. Its IUPAC name is 5-(3,3-dimethylbutanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 5-(3,3-dimethylbutanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 1064588 |
| Molecular Formula | C30H43N5O4 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | 5-(3,3-dimethylbutanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)CC(C)(C)C)cc2C(=O)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C30H43N5O4/c1-30(2,3)22-28(36)32-23-9-10-25(24(21-23)29(37)31-11-12-33-17-19-39-20-18-33)34-13-15-35(16-14-34)26-7-5-6-8-27(26)38-4/h5-10,21H,11-20,22H2,1-4H3,(H,31,37)(H,32,36) |
| InChIKey | VOGLGXKOFFDPMN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|