C32H49N5O3 — CID 4302018
N-[3-(dimethylamino)propyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3,5,5-trimethylhexanoylamino)benzamide (PubChem CID 4302018) has the molecular formula C32H49N5O3 and a molecular weight of 551.78 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3,5,5-trimethylhexanoylamino)benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3,5,5-trimethylhexanoylamino)benzamide |
|---|---|
| PubChem CID | 4302018 |
| Molecular Formula | C32H49N5O3 |
| Molecular Weight | 551.78 g/mol |
| Exact Mass | 551.38 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3,5,5-trimethylhexanoylamino)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)CC(C)CC(C)(C)C)cc2C(=O)NCCCN(C)C)CC1 |
| InChI | InChI=1S/C32H49N5O3/c1-24(23-32(2,3)4)21-30(38)34-25-13-14-27(26(22-25)31(39)33-15-10-16-35(5)6)36-17-19-37(20-18-36)28-11-8-9-12-29(28)40-7/h8-9,11-14,22,24H,10,15-21,23H2,1-7H3,(H,33,39)(H,34,38) |
| InChIKey | FMFRZSNYIPDRCO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.78 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|