C27H38N4O4 — CID 3960007
N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(2-methylpropanoylamino)benzamide (PubChem CID 3960007) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(2-methylpropanoylamino)benzamide.
| Compound Name | N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 3960007 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(2-methylpropanoylamino)benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)C(C)C)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C27H38N4O4/c1-5-35-18-8-13-28-27(33)22-19-21(29-26(32)20(2)3)11-12-23(22)30-14-16-31(17-15-30)24-9-6-7-10-25(24)34-4/h6-7,9-12,19-20H,5,8,13-18H2,1-4H3,(H,28,33)(H,29,32) |
| InChIKey | FKZYBNZWQSUWOL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|