C32H40N4O6 — CID 5158439
5-[(2,4-dimethoxybenzoyl)amino]-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 5158439) has the molecular formula C32H40N4O6 and a molecular weight of 576.69 g/mol. Its IUPAC name is 5-[(2,4-dimethoxybenzoyl)amino]-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[(2,4-dimethoxybenzoyl)amino]-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 5158439 |
| Molecular Formula | C32H40N4O6 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | 5-[(2,4-dimethoxybenzoyl)amino]-N-(3-ethoxypropyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)c2ccc(OC)cc2OC)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C32H40N4O6/c1-5-42-20-8-15-33-31(37)26-21-23(34-32(38)25-13-12-24(39-2)22-30(25)41-4)11-14-27(26)35-16-18-36(19-17-35)28-9-6-7-10-29(28)40-3/h6-7,9-14,21-22H,5,8,15-20H2,1-4H3,(H,33,37)(H,34,38) |
| InChIKey | BJSPFFBBXVMJRF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|