C34H36N4O5 — CID 1064743
N-benzyl-5-[(2,4-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 1064743) has the molecular formula C34H36N4O5 and a molecular weight of 580.69 g/mol. Its IUPAC name is N-benzyl-5-[(2,4-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-benzyl-5-[(2,4-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 1064743 |
| Molecular Formula | C34H36N4O5 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | N-benzyl-5-[(2,4-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCN(c4ccccc4OC)CC3)c(C(=O)NCc3ccccc3)c2)c(OC)c1 |
| InChI | InChI=1S/C34H36N4O5/c1-41-26-14-15-27(32(22-26)43-3)34(40)36-25-13-16-29(28(21-25)33(39)35-23-24-9-5-4-6-10-24)37-17-19-38(20-18-37)30-11-7-8-12-31(30)42-2/h4-16,21-22H,17-20,23H2,1-3H3,(H,35,39)(H,36,40) |
| InChIKey | KRPIPQMPSZJZKU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|