C29H32FN3O4 — CID 1054167
5-[(2,4-dimethoxybenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 1054167) has the molecular formula C29H32FN3O4 and a molecular weight of 505.59 g/mol. Its IUPAC name is 5-[(2,4-dimethoxybenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | 5-[(2,4-dimethoxybenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 1054167 |
| Molecular Formula | C29H32FN3O4 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 5-[(2,4-dimethoxybenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCC(C)CC3)c(C(=O)NCc3ccc(F)cc3)c2)c(OC)c1 |
| InChI | InChI=1S/C29H32FN3O4/c1-19-12-14-33(15-13-19)26-11-8-22(32-29(35)24-10-9-23(36-2)17-27(24)37-3)16-25(26)28(34)31-18-20-4-6-21(30)7-5-20/h4-11,16-17,19H,12-15,18H2,1-3H3,(H,31,34)(H,32,35) |
| InChIKey | WDXNHHBGVKOZSK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|