C31H36FN3O3 — CID 3526852
5-[(4-butoxybenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 3526852) has the molecular formula C31H36FN3O3 and a molecular weight of 517.65 g/mol. Its IUPAC name is 5-[(4-butoxybenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | 5-[(4-butoxybenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 3526852 |
| Molecular Formula | C31H36FN3O3 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | 5-[(4-butoxybenzoyl)amino]-N-[(4-fluorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(N3CCC(C)CC3)c(C(=O)NCc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C31H36FN3O3/c1-3-4-19-38-27-12-7-24(8-13-27)30(36)34-26-11-14-29(35-17-15-22(2)16-18-35)28(20-26)31(37)33-21-23-5-9-25(32)10-6-23/h5-14,20,22H,3-4,15-19,21H2,1-2H3,(H,33,37)(H,34,36) |
| InChIKey | JKNMMXDZUFVNNJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|