C28H39N3O2 — CID 4207320
5-[(4-butylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide (PubChem CID 4207320) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is 5-[(4-butylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide.
| Compound Name | 5-[(4-butylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 4207320 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 5-[(4-butylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide |
| SMILES | CCCCc1ccc(C(=O)Nc2ccc(N3CCC(C)CC3)c(C(=O)NCC(C)C)c2)cc1 |
| InChI | InChI=1S/C28H39N3O2/c1-5-6-7-22-8-10-23(11-9-22)27(32)30-24-12-13-26(31-16-14-21(4)15-17-31)25(18-24)28(33)29-19-20(2)3/h8-13,18,20-21H,5-7,14-17,19H2,1-4H3,(H,29,33)(H,30,32) |
| InChIKey | HSDLUARGZMBDQA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|