C21H32ClN3O2 — CID 4297943
5-(4-chlorobutanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide (PubChem CID 4297943) has the molecular formula C21H32ClN3O2 and a molecular weight of 393.96 g/mol. Its IUPAC name is 5-(4-chlorobutanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide.
| Compound Name | 5-(4-chlorobutanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 4297943 |
| Molecular Formula | C21H32ClN3O2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 5-(4-chlorobutanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1cc(NC(=O)CCCCl)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C21H32ClN3O2/c1-15(2)14-23-21(27)18-13-17(24-20(26)5-4-10-22)6-7-19(18)25-11-8-16(3)9-12-25/h6-7,13,15-16H,4-5,8-12,14H2,1-3H3,(H,23,27)(H,24,26) |
| InChIKey | ISQKXSGBBOTYNQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|