C19H27Cl2N3O2 — CID 1063125
5-[(2,2-dichloroacetyl)amino]-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide (PubChem CID 1063125) has the molecular formula C19H27Cl2N3O2 and a molecular weight of 400.35 g/mol. Its IUPAC name is 5-[(2,2-dichloroacetyl)amino]-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide.
| Compound Name | 5-[(2,2-dichloroacetyl)amino]-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 1063125 |
| Molecular Formula | C19H27Cl2N3O2 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 5-[(2,2-dichloroacetyl)amino]-2-(4-methylpiperidin-1-yl)-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1cc(NC(=O)C(Cl)Cl)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C19H27Cl2N3O2/c1-12(2)11-22-18(25)15-10-14(23-19(26)17(20)21)4-5-16(15)24-8-6-13(3)7-9-24/h4-5,10,12-13,17H,6-9,11H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | YUBPGRWJMHUOJI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|