C23H28ClN3O2 — CID 1064769
N-benzyl-5-[[(2R)-2-chloropropanoyl]amino]-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 1064769) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is N-benzyl-5-[[(2R)-2-chloropropanoyl]amino]-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | N-benzyl-5-[[(2R)-2-chloropropanoyl]amino]-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 1064769 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-benzyl-5-[[(2R)-2-chloropropanoyl]amino]-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)[C@@H](C)Cl)cc2C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-16-10-12-27(13-11-16)21-9-8-19(26-22(28)17(2)24)14-20(21)23(29)25-15-18-6-4-3-5-7-18/h3-9,14,16-17H,10-13,15H2,1-2H3,(H,25,29)(H,26,28)/t17-/m1/s1 |
| InChIKey | HUHHMABYVGBZNR-QGZVFWFLSA-N |
| XLogP | 4.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|