C26H29N3O2S — CID 1064756
N-benzyl-2-(4-methylpiperidin-1-yl)-5-[(2-thiophen-2-ylacetyl)amino]benzamide (PubChem CID 1064756) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is N-benzyl-2-(4-methylpiperidin-1-yl)-5-[(2-thiophen-2-ylacetyl)amino]benzamide.
| Compound Name | N-benzyl-2-(4-methylpiperidin-1-yl)-5-[(2-thiophen-2-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 1064756 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-benzyl-2-(4-methylpiperidin-1-yl)-5-[(2-thiophen-2-ylacetyl)amino]benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)Cc3cccs3)cc2C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O2S/c1-19-11-13-29(14-12-19)24-10-9-21(28-25(30)17-22-8-5-15-32-22)16-23(24)26(31)27-18-20-6-3-2-4-7-20/h2-10,15-16,19H,11-14,17-18H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | ZKUUAOZJSFHALI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|