C28H34N4O3S — CID 42752775
2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-methylpropyl)-5-[(2-thiophen-2-ylacetyl)amino]benzamide (PubChem CID 42752775) has the molecular formula C28H34N4O3S and a molecular weight of 506.67 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-methylpropyl)-5-[(2-thiophen-2-ylacetyl)amino]benzamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-methylpropyl)-5-[(2-thiophen-2-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 42752775 |
| Molecular Formula | C28H34N4O3S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-methylpropyl)-5-[(2-thiophen-2-ylacetyl)amino]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Cc3cccs3)cc2C(=O)NCC(C)C)CC1 |
| InChI | InChI=1S/C28H34N4O3S/c1-20(2)19-29-28(34)23-17-21(30-27(33)18-22-7-6-16-36-22)10-11-24(23)31-12-14-32(15-13-31)25-8-4-5-9-26(25)35-3/h4-11,16-17,20H,12-15,18-19H2,1-3H3,(H,29,34)(H,30,33) |
| InChIKey | UMMJRZSKUUBYEQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|