C30H36N4O5 — CID 42756008
N-(2-methoxyethyl)-5-[[2-(4-methoxyphenyl)acetyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42756008) has the molecular formula C30H36N4O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[[2-(4-methoxyphenyl)acetyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-(2-methoxyethyl)-5-[[2-(4-methoxyphenyl)acetyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42756008 |
| Molecular Formula | C30H36N4O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | N-(2-methoxyethyl)-5-[[2-(4-methoxyphenyl)acetyl]amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)Cc2ccc(OC)cc2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C30H36N4O5/c1-37-19-14-31-30(36)25-21-23(32-29(35)20-22-8-11-24(38-2)12-9-22)10-13-26(25)33-15-17-34(18-16-33)27-6-4-5-7-28(27)39-3/h4-13,21H,14-20H2,1-3H3,(H,31,36)(H,32,35) |
| InChIKey | PDVWANVLBCLKJY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|